About tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate
tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate (PubChem CID 138000136) has the molecular formula C14H23NO2S
and a molecular weight of 269.41 g/mol. Its IUPAC name is tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate |
| PubChem CID | 138000136 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate |
| SMILES | Cc1scc(CNCCC(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C14H23NO2S/c1-10-11(2)18-9-12(10)8-15-7-6-13(16)17-14(3,4)5/h9,15H,6-8H2,1-5H3 |
| InChIKey | BXCWWRMATWTLPI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate?
The IUPAC name of tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate (CID 138000136) is tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate.
What is the SMILES notation for tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate?
The canonical SMILES for tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate is Cc1scc(CNCCC(=O)OC(C)(C)C)c1C.
What is the InChIKey of tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate?
The InChIKey is BXCWWRMATWTLPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO2S/c1-10-11(2)18-9-12(10)8-15-7-6-13(16)17-14(3,4)5/h9,15H,6-8H2,1-5H3.
What are the key properties of tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate?
tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate has a molecular weight of 269.41 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[(4,5-dimethylthiophen-3-yl)methylamino]propanoate is sourced from PubChem (CID 138000136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).