C13H19N7O — CID 138000215
N-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 138000215) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 138000215 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCn1cc(CN(C)C(=O)c2nc3n(n2)CCCN3)cn1 |
| InChI | InChI=1S/C13H19N7O/c1-3-19-9-10(7-15-19)8-18(2)12(21)11-16-13-14-5-4-6-20(13)17-11/h7,9H,3-6,8H2,1-2H3,(H,14,16,17) |
| InChIKey | GKYZFIDNVYPNPW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |