C11H16F3N5O2 — CID 138000497
(2S,4R)-4-methoxy-2-(1H-1,2,4-triazol-5-yl)-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrrolidine-1-carboxamide (PubChem CID 138000497) has the molecular formula C11H16F3N5O2 and a molecular weight of 307.28 g/mol. Its IUPAC name is (2S,4R)-4-methoxy-2-(1H-1,2,4-triazol-5-yl)-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrrolidine-1-carboxamide.
| Compound Name | (2S,4R)-4-methoxy-2-(1H-1,2,4-triazol-5-yl)-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 138000497 |
| Molecular Formula | C11H16F3N5O2 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (2S,4R)-4-methoxy-2-(1H-1,2,4-triazol-5-yl)-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrrolidine-1-carboxamide |
| SMILES | CO[C@@H]1C[C@@H](c2ncn[nH]2)N(C(=O)N[C@H](C)C(F)(F)F)C1 |
| InChI | InChI=1S/C11H16F3N5O2/c1-6(11(12,13)14)17-10(20)19-4-7(21-2)3-8(19)9-15-5-16-18-9/h5-8H,3-4H2,1-2H3,(H,17,20)(H,15,16,18)/t6-,7-,8+/m1/s1 |
| InChIKey | VEQDMTBQCPWYFS-PRJMDXOYSA-N |
| XLogP | 1.23 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |