About 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol
2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol (PubChem CID 138000625) has the molecular formula C17H24F2N2O
and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol |
| PubChem CID | 138000625 |
| Molecular Formula | C17H24F2N2O |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol |
| SMILES | OC(CNC1CCN(C2CCC2)CC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H24F2N2O/c18-12-4-5-16(19)15(10-12)17(22)11-20-13-6-8-21(9-7-13)14-2-1-3-14/h4-5,10,13-14,17,20,22H,1-3,6-9,11H2 |
| InChIKey | DMDRMKVVMKDCDN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol?
The IUPAC name of 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol (CID 138000625) is 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol.
What is the SMILES notation for 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol?
The canonical SMILES for 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol is OC(CNC1CCN(C2CCC2)CC1)c1cc(F)ccc1F.
What is the InChIKey of 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol?
The InChIKey is DMDRMKVVMKDCDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F2N2O/c18-12-4-5-16(19)15(10-12)17(22)11-20-13-6-8-21(9-7-13)14-2-1-3-14/h4-5,10,13-14,17,20,22H,1-3,6-9,11H2.
What are the key properties of 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol?
2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol has a molecular weight of 310.39 g/mol, XLogP of 2.60, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-cyclobutylpiperidin-4-yl)amino]-1-(2,5-difluorophenyl)ethanol is sourced from PubChem (CID 138000625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).