C14H16N6S — CID 138000874
N-[(2-ethyl-5-methyltriazol-4-yl)methyl]-6-thiophen-2-ylpyrazin-2-amine (PubChem CID 138000874) has the molecular formula C14H16N6S and a molecular weight of 300.39 g/mol. Its IUPAC name is N-[(2-ethyl-5-methyltriazol-4-yl)methyl]-6-thiophen-2-ylpyrazin-2-amine.
| Compound Name | N-[(2-ethyl-5-methyltriazol-4-yl)methyl]-6-thiophen-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 138000874 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-[(2-ethyl-5-methyltriazol-4-yl)methyl]-6-thiophen-2-ylpyrazin-2-amine |
| SMILES | CCn1nc(C)c(CNc2cncc(-c3cccs3)n2)n1 |
| InChI | InChI=1S/C14H16N6S/c1-3-20-18-10(2)11(19-20)8-16-14-9-15-7-12(17-14)13-5-4-6-21-13/h4-7,9H,3,8H2,1-2H3,(H,16,17) |
| InChIKey | VGUGAMVYIDPFBA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |