About N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide
N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide (PubChem CID 138001615) has the molecular formula C16H19F2N5O
and a molecular weight of 335.36 g/mol. Its IUPAC name is N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide |
| PubChem CID | 138001615 |
| Molecular Formula | C16H19F2N5O |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide |
| SMILES | Cc1nccn1-c1ccnc(C(=O)NCC2CCNCC2(F)F)c1 |
| InChI | InChI=1S/C16H19F2N5O/c1-11-20-6-7-23(11)13-3-5-21-14(8-13)15(24)22-9-12-2-4-19-10-16(12,17)18/h3,5-8,12,19H,2,4,9-10H2,1H3,(H,22,24) |
| InChIKey | NSKZEOZLRIZKDB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide?
The IUPAC name of N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide (CID 138001615) is N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide.
What is the SMILES notation for N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide?
The canonical SMILES for N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide is Cc1nccn1-c1ccnc(C(=O)NCC2CCNCC2(F)F)c1.
What is the InChIKey of N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide?
The InChIKey is NSKZEOZLRIZKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2N5O/c1-11-20-6-7-23(11)13-3-5-21-14(8-13)15(24)22-9-12-2-4-19-10-16(12,17)18/h3,5-8,12,19H,2,4,9-10H2,1H3,(H,22,24).
What are the key properties of N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide?
N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide has a molecular weight of 335.36 g/mol, XLogP of 1.55, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluoropiperidin-4-yl)methyl]-4-(2-methylimidazol-1-yl)pyridine-2-carboxamide is sourced from PubChem (CID 138001615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).