About 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide
1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide (PubChem CID 138002411) has the molecular formula C18H23F3N2O
and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide |
| PubChem CID | 138002411 |
| Molecular Formula | C18H23F3N2O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@H]1C(F)(F)F)C1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C18H23F3N2O/c19-18(20,21)15-8-4-5-9-16(15)22-17(24)13-10-11-23(12-13)14-6-2-1-3-7-14/h1-3,6-7,13,15-16H,4-5,8-12H2,(H,22,24)/t13?,15-,16+/m1/s1 |
| InChIKey | AYOMIILLGQWRHC-CZVYVAOFSA-N |
| XLogP | 3.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide?
The IUPAC name of 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide (CID 138002411) is 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide.
What is the SMILES notation for 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide?
The canonical SMILES for 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide is O=C(N[C@H]1CCCC[C@H]1C(F)(F)F)C1CCN(c2ccccc2)C1.
What is the InChIKey of 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide?
The InChIKey is AYOMIILLGQWRHC-CZVYVAOFSA-N. The full InChI is InChI=1S/C18H23F3N2O/c19-18(20,21)15-8-4-5-9-16(15)22-17(24)13-10-11-23(12-13)14-6-2-1-3-7-14/h1-3,6-7,13,15-16H,4-5,8-12H2,(H,22,24)/t13?,15-,16+/m1/s1.
What are the key properties of 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide?
1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide has a molecular weight of 340.39 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxamide is sourced from PubChem (CID 138002411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).