C13H22N6O — CID 138002867
N-[(1R,3S)-3-(dimethylamino)cyclopentyl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 138002867) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[(1R,3S)-3-(dimethylamino)cyclopentyl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(1R,3S)-3-(dimethylamino)cyclopentyl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 138002867 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | N-[(1R,3S)-3-(dimethylamino)cyclopentyl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CN(C)[C@H]1CC[C@@H](NC(=O)c2nc3n(n2)CCCN3)C1 |
| InChI | InChI=1S/C13H22N6O/c1-18(2)10-5-4-9(8-10)15-12(20)11-16-13-14-6-3-7-19(13)17-11/h9-10H,3-8H2,1-2H3,(H,15,20)(H,14,16,17)/t9-,10+/m1/s1 |
| InChIKey | HGTWNHNIWWPSAT-ZJUUUORDSA-N |
| XLogP | 0.31 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |