About ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate
ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate (PubChem CID 1380030) has the molecular formula C16H15Cl2NO4
and a molecular weight of 356.21 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
| PubChem CID | 1380030 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO4/c1-3-21-16(20)10(2)22-12-4-6-13(7-5-12)23-15-14(18)8-11(17)9-19-15/h4-10H,3H2,1-2H3/t10-/m1/s1 |
| InChIKey | JNYFNQWRGSQZQC-SNVBAGLBSA-N |
| XLogP | 4.51 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
The IUPAC name of ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate (CID 1380030) is ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate.
What is the SMILES notation for ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
The canonical SMILES for ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate is CCOC(=O)[C@@H](C)Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1.
What is the InChIKey of ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
The InChIKey is JNYFNQWRGSQZQC-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H15Cl2NO4/c1-3-21-16(20)10(2)22-12-4-6-13(7-5-12)23-15-14(18)8-11(17)9-19-15/h4-10H,3H2,1-2H3/t10-/m1/s1.
What are the key properties of ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate has a molecular weight of 356.21 g/mol, XLogP of 4.51, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate is sourced from PubChem (CID 1380030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).