About N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide
N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide (PubChem CID 138003275) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide |
| PubChem CID | 138003275 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(-c2cnn(C)c2)oc1C(=O)N[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C15H22N4O2/c1-9-12(13(20)18-10(2)15(3,4)5)21-14(17-9)11-7-16-19(6)8-11/h7-8,10H,1-6H3,(H,18,20)/t10-/m1/s1 |
| InChIKey | WSIUEMBWYMJEEE-SNVBAGLBSA-N |
| XLogP | 2.55 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide?
The IUPAC name of N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide (CID 138003275) is N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide.
What is the SMILES notation for N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide?
The canonical SMILES for N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide is Cc1nc(-c2cnn(C)c2)oc1C(=O)N[C@H](C)C(C)(C)C.
What is the InChIKey of N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide?
The InChIKey is WSIUEMBWYMJEEE-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-9-12(13(20)18-10(2)15(3,4)5)21-14(17-9)11-7-16-19(6)8-11/h7-8,10H,1-6H3,(H,18,20)/t10-/m1/s1.
What are the key properties of N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide?
N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide has a molecular weight of 290.37 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-3,3-dimethylbutan-2-yl]-4-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 138003275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).