About 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid
3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid (PubChem CID 138003729) has the molecular formula C14H14F2N2O3
and a molecular weight of 296.27 g/mol. Its IUPAC name is 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid |
| PubChem CID | 138003729 |
| Molecular Formula | C14H14F2N2O3 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid |
| SMILES | Cc1onc(CN(C)Cc2ccc(F)c(F)c2)c1C(=O)O |
| InChI | InChI=1S/C14H14F2N2O3/c1-8-13(14(19)20)12(17-21-8)7-18(2)6-9-3-4-10(15)11(16)5-9/h3-5H,6-7H2,1-2H3,(H,19,20) |
| InChIKey | KEYWIMFVBCTRAV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid (CID 138003729) is 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid is Cc1onc(CN(C)Cc2ccc(F)c(F)c2)c1C(=O)O.
What is the InChIKey of 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid?
The InChIKey is KEYWIMFVBCTRAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N2O3/c1-8-13(14(19)20)12(17-21-8)7-18(2)6-9-3-4-10(15)11(16)5-9/h3-5H,6-7H2,1-2H3,(H,19,20).
What are the key properties of 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid?
3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid has a molecular weight of 296.27 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3,4-difluorophenyl)methyl-methylamino]methyl]-5-methyl-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 138003729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).