C18H20FNO2S — CID 138004005
3-[[4-[(2-fluorophenyl)methyl]piperidin-1-yl]methyl]thiophene-2-carboxylic acid (PubChem CID 138004005) has the molecular formula C18H20FNO2S and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-[[4-[(2-fluorophenyl)methyl]piperidin-1-yl]methyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[4-[(2-fluorophenyl)methyl]piperidin-1-yl]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 138004005 |
| Molecular Formula | C18H20FNO2S |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 3-[[4-[(2-fluorophenyl)methyl]piperidin-1-yl]methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1CN1CCC(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C18H20FNO2S/c19-16-4-2-1-3-14(16)11-13-5-8-20(9-6-13)12-15-7-10-23-17(15)18(21)22/h1-4,7,10,13H,5-6,8-9,11-12H2,(H,21,22) |
| InChIKey | WCAQBLMPONBBRZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |