About 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone
1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone (PubChem CID 138004093) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone |
| PubChem CID | 138004093 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone |
| SMILES | Cc1cc(CC(=O)N2CCC(O)CC23CCC3)on1 |
| InChI | InChI=1S/C14H20N2O3/c1-10-7-12(19-15-10)8-13(18)16-6-3-11(17)9-14(16)4-2-5-14/h7,11,17H,2-6,8-9H2,1H3 |
| InChIKey | VLTYECJBLQIHTK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone?
The IUPAC name of 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone (CID 138004093) is 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone.
What is the SMILES notation for 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone?
The canonical SMILES for 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone is Cc1cc(CC(=O)N2CCC(O)CC23CCC3)on1.
What is the InChIKey of 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone?
The InChIKey is VLTYECJBLQIHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-10-7-12(19-15-10)8-13(18)16-6-3-11(17)9-14(16)4-2-5-14/h7,11,17H,2-6,8-9H2,1H3.
What are the key properties of 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone?
1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone has a molecular weight of 264.32 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-hydroxy-5-azaspiro[3.5]nonan-5-yl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone is sourced from PubChem (CID 138004093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).