About (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone
(3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone (PubChem CID 138004361) has the molecular formula C19H25N3O
and a molecular weight of 311.43 g/mol. Its IUPAC name is (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone.
Molecular Properties
| Compound Name | (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone |
| PubChem CID | 138004361 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone |
| SMILES | CC1CC2(CCNCC2)CN1C(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C19H25N3O/c1-14-12-19(7-9-20-10-8-19)13-22(14)18(23)17-11-15-5-3-4-6-16(15)21(17)2/h3-6,11,14,20H,7-10,12-13H2,1-2H3 |
| InChIKey | MKLSVTNWVLXWHM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone?
The IUPAC name of (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone (CID 138004361) is (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone.
What is the SMILES notation for (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone?
The canonical SMILES for (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone is CC1CC2(CCNCC2)CN1C(=O)c1cc2ccccc2n1C.
What is the InChIKey of (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone?
The InChIKey is MKLSVTNWVLXWHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O/c1-14-12-19(7-9-20-10-8-19)13-22(14)18(23)17-11-15-5-3-4-6-16(15)21(17)2/h3-6,11,14,20H,7-10,12-13H2,1-2H3.
What are the key properties of (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone?
(3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone has a molecular weight of 311.43 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2,8-diazaspiro[4.5]decan-2-yl)-(1-methylindol-2-yl)methanone is sourced from PubChem (CID 138004361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).