C16H18FN5O2 — CID 138005571
[4-(6-amino-5-methoxypyrimidin-4-yl)piperazin-1-yl]-(3-fluorophenyl)methanone (PubChem CID 138005571) has the molecular formula C16H18FN5O2 and a molecular weight of 331.35 g/mol. Its IUPAC name is [4-(6-amino-5-methoxypyrimidin-4-yl)piperazin-1-yl]-(3-fluorophenyl)methanone.
| Compound Name | [4-(6-amino-5-methoxypyrimidin-4-yl)piperazin-1-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 138005571 |
| Molecular Formula | C16H18FN5O2 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [4-(6-amino-5-methoxypyrimidin-4-yl)piperazin-1-yl]-(3-fluorophenyl)methanone |
| SMILES | COc1c(N)ncnc1N1CCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C16H18FN5O2/c1-24-13-14(18)19-10-20-15(13)21-5-7-22(8-6-21)16(23)11-3-2-4-12(17)9-11/h2-4,9-10H,5-8H2,1H3,(H2,18,19,20) |
| InChIKey | FLVJGUXWGCKFQV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |