About tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate
tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate (PubChem CID 138005794) has the molecular formula C12H16F3NO5S
and a molecular weight of 343.32 g/mol. Its IUPAC name is tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate.
Molecular Properties
| Compound Name | tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate |
| PubChem CID | 138005794 |
| Molecular Formula | C12H16F3NO5S |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(NS(=O)(=O)c1ccoc1)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO5S/c1-10(2,3)21-9(17)11(4,12(13,14)15)16-22(18,19)8-5-6-20-7-8/h5-7,16H,1-4H3 |
| InChIKey | ICOOKWHGQMLHBD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate?
The IUPAC name of tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate (CID 138005794) is tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate.
What is the SMILES notation for tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate?
The canonical SMILES for tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate is CC(C)(C)OC(=O)C(C)(NS(=O)(=O)c1ccoc1)C(F)(F)F.
What is the InChIKey of tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate?
The InChIKey is ICOOKWHGQMLHBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NO5S/c1-10(2,3)21-9(17)11(4,12(13,14)15)16-22(18,19)8-5-6-20-7-8/h5-7,16H,1-4H3.
What are the key properties of tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate?
tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate has a molecular weight of 343.32 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,3,3-trifluoro-2-(furan-3-ylsulfonylamino)-2-methylpropanoate is sourced from PubChem (CID 138005794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).