C16H15N5O — CID 138006007
5-(4-methoxyphenyl)-5-methyl-6H-tetrazolo[1,5-c]quinazoline (PubChem CID 138006007) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-5-methyl-6H-tetrazolo[1,5-c]quinazoline.
| Compound Name | 5-(4-methoxyphenyl)-5-methyl-6H-tetrazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 138006007 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 5-(4-methoxyphenyl)-5-methyl-6H-tetrazolo[1,5-c]quinazoline |
| SMILES | COc1ccc(C2(C)Nc3ccccc3-c3nnnn32)cc1 |
| InChI | InChI=1S/C16H15N5O/c1-16(11-7-9-12(22-2)10-8-11)17-14-6-4-3-5-13(14)15-18-19-20-21(15)16/h3-10,17H,1-2H3 |
| InChIKey | DBNBABLEYQRNSX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |