About 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one
6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one (PubChem CID 138006181) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one.
Molecular Properties
| Compound Name | 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one |
| PubChem CID | 138006181 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one |
| SMILES | Cc1cc2n(n1)CC(=O)N2 |
| InChI | InChI=1S/C6H7N3O/c1-4-2-5-7-6(10)3-9(5)8-4/h2H,3H2,1H3,(H,7,10) |
| InChIKey | FRZMIPNZZBOVRS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one?
The IUPAC name of 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one (CID 138006181) is 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one.
What is the SMILES notation for 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one?
The canonical SMILES for 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one is Cc1cc2n(n1)CC(=O)N2.
What is the InChIKey of 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one?
The InChIKey is FRZMIPNZZBOVRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c1-4-2-5-7-6(10)3-9(5)8-4/h2H,3H2,1H3,(H,7,10).
What are the key properties of 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one?
6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one has a molecular weight of 137.14 g/mol, XLogP of 0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,3-dihydroimidazo[1,2-b]pyrazol-2-one is sourced from PubChem (CID 138006181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).