About 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide
2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide (PubChem CID 138006531) has the molecular formula C12H22F3N3O3S
and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide |
| PubChem CID | 138006531 |
| Molecular Formula | C12H22F3N3O3S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1C[C@H](C(F)(F)F)[C@@H](S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C12H22F3N3O3S/c1-4-5-16-11(19)8-18-6-9(12(13,14)15)10(7-18)22(20,21)17(2)3/h9-10H,4-8H2,1-3H3,(H,16,19)/t9-,10-/m0/s1 |
| InChIKey | FIQPKUSNRQCPOZ-UWVGGRQHSA-N |
| XLogP | 0.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide?
The IUPAC name of 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide (CID 138006531) is 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide.
What is the SMILES notation for 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide?
The canonical SMILES for 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide is CCCNC(=O)CN1C[C@H](C(F)(F)F)[C@@H](S(=O)(=O)N(C)C)C1.
What is the InChIKey of 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide?
The InChIKey is FIQPKUSNRQCPOZ-UWVGGRQHSA-N. The full InChI is InChI=1S/C12H22F3N3O3S/c1-4-5-16-11(19)8-18-6-9(12(13,14)15)10(7-18)22(20,21)17(2)3/h9-10H,4-8H2,1-3H3,(H,16,19)/t9-,10-/m0/s1.
What are the key properties of 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide?
2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide has a molecular weight of 345.39 g/mol, XLogP of 0.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4R)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]-N-propylacetamide is sourced from PubChem (CID 138006531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).