About 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride
8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride (PubChem CID 138006717) has the molecular formula C7H14ClNO3S
and a molecular weight of 227.71 g/mol. Its IUPAC name is 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride.
Molecular Properties
| Compound Name | 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride |
| PubChem CID | 138006717 |
| Molecular Formula | C7H14ClNO3S |
| Molecular Weight | 227.71 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride |
| SMILES | Cl.[H]N=S1(=O)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C7H13NO3S.ClH/c8-12(9)5-1-7(2-6-12)10-3-4-11-7;/h8H,1-6H2;1H |
| InChIKey | JMLMQDTVRJUSMY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.71 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride?
The IUPAC name of 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride (CID 138006717) is 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride.
What is the SMILES notation for 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride?
The canonical SMILES for 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride is Cl.[H]N=S1(=O)CCC2(CC1)OCCO2.
What is the InChIKey of 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride?
The InChIKey is JMLMQDTVRJUSMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3S.ClH/c8-12(9)5-1-7(2-6-12)10-3-4-11-7;/h8H,1-6H2;1H.
What are the key properties of 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride?
8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride has a molecular weight of 227.71 g/mol, XLogP of 0.99, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-imino-1,4-dioxa-8λ6-thiaspiro[4.5]decane 8-oxide;hydrochloride is sourced from PubChem (CID 138006717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).