C21H33N3O3 — CID 138007230
N-[1-(3-ethylpentanoyl)piperidin-3-yl]-N-methyl-2-(4-methyl-2-oxo-1-pyridinyl)acetamide (PubChem CID 138007230) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is N-[1-(3-ethylpentanoyl)piperidin-3-yl]-N-methyl-2-(4-methyl-2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-[1-(3-ethylpentanoyl)piperidin-3-yl]-N-methyl-2-(4-methyl-2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 138007230 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | N-[1-(3-ethylpentanoyl)piperidin-3-yl]-N-methyl-2-(4-methyl-2-oxo-1-pyridinyl)acetamide |
| SMILES | CCC(CC)CC(=O)N1CCCC(N(C)C(=O)Cn2ccc(C)cc2=O)C1 |
| InChI | InChI=1S/C21H33N3O3/c1-5-17(6-2)13-20(26)23-10-7-8-18(14-23)22(4)21(27)15-24-11-9-16(3)12-19(24)25/h9,11-12,17-18H,5-8,10,13-15H2,1-4H3 |
| InChIKey | IBPCCRYZUDKMCE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |