C9H17FNO3S+ — CID 138007971
(2-fluoro-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-4-yl)methanol (PubChem CID 138007971) has the molecular formula C9H17FNO3S+ and a molecular weight of 238.30 g/mol. Its IUPAC name is (2-fluoro-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-4-yl)methanol.
| Compound Name | (2-fluoro-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-4-yl)methanol |
|---|---|
| PubChem CID | 138007971 |
| Molecular Formula | C9H17FNO3S+ |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (2-fluoro-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-4-yl)methanol |
| SMILES | O=S1(=O)CC[N+]2(CC1)CC(F)CC2CO |
| InChI | InChI=1S/C9H17FNO3S/c10-8-5-9(7-12)11(6-8)1-3-15(13,14)4-2-11/h8-9,12H,1-7H2/q+1 |
| InChIKey | MAUPOFUIVZQARS-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|