About 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea
1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea (PubChem CID 138008216) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea.
Molecular Properties
| Compound Name | 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea |
| PubChem CID | 138008216 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea |
| SMILES | CNC(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C9H18N2O/c1-7-5-3-4-6-8(7)11-9(12)10-2/h7-8H,3-6H2,1-2H3,(H2,10,11,12)/t7-,8+/m0/s1 |
| InChIKey | LFVKHLRMUDVHKR-JGVFFNPUSA-N |
| XLogP | 1.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea?
The IUPAC name of 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea (CID 138008216) is 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea.
What is the SMILES notation for 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea?
The canonical SMILES for 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea is CNC(=O)N[C@@H]1CCCC[C@@H]1C.
What is the InChIKey of 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea?
The InChIKey is LFVKHLRMUDVHKR-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H18N2O/c1-7-5-3-4-6-8(7)11-9(12)10-2/h7-8H,3-6H2,1-2H3,(H2,10,11,12)/t7-,8+/m0/s1.
What are the key properties of 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea?
1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea has a molecular weight of 170.26 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[(1R,2S)-2-methylcyclohexyl]urea is sourced from PubChem (CID 138008216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).