C14H18F3N7 — CID 138008451
N,5,6-trimethyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1,2,4-triazin-3-amine (PubChem CID 138008451) has the molecular formula C14H18F3N7 and a molecular weight of 341.34 g/mol. Its IUPAC name is N,5,6-trimethyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1,2,4-triazin-3-amine.
| Compound Name | N,5,6-trimethyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 138008451 |
| Molecular Formula | C14H18F3N7 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N,5,6-trimethyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(N(C)Cc2nnc3n2CC(C(F)(F)F)CC3)nc1C |
| InChI | InChI=1S/C14H18F3N7/c1-8-9(2)19-22-13(18-8)23(3)7-12-21-20-11-5-4-10(6-24(11)12)14(15,16)17/h10H,4-7H2,1-3H3 |
| InChIKey | KJIQTNJMAHJJFZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |