C13H11F5N2O2 — CID 138008650
4,6-difluoro-9-methyl-10-(2,2,2-trifluoroethyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one (PubChem CID 138008650) has the molecular formula C13H11F5N2O2 and a molecular weight of 322.23 g/mol. Its IUPAC name is 4,6-difluoro-9-methyl-10-(2,2,2-trifluoroethyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one.
| Compound Name | 4,6-difluoro-9-methyl-10-(2,2,2-trifluoroethyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 138008650 |
| Molecular Formula | C13H11F5N2O2 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4,6-difluoro-9-methyl-10-(2,2,2-trifluoroethyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
| SMILES | CC12CC(NC(=O)N1CC(F)(F)F)c1cc(F)cc(F)c1O2 |
| InChI | InChI=1S/C13H11F5N2O2/c1-12-4-9(19-11(21)20(12)5-13(16,17)18)7-2-6(14)3-8(15)10(7)22-12/h2-3,9H,4-5H2,1H3,(H,19,21) |
| InChIKey | FADCJSPJAXCEIO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |