C14H24N4O2S — CID 138009395
1-(3-methylcyclohexyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)methanesulfonamide (PubChem CID 138009395) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-(3-methylcyclohexyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)methanesulfonamide.
| Compound Name | 1-(3-methylcyclohexyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)methanesulfonamide |
|---|---|
| PubChem CID | 138009395 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-(3-methylcyclohexyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)methanesulfonamide |
| SMILES | CC1CCCC(CS(=O)(=O)NC2CCCn3ncnc32)C1 |
| InChI | InChI=1S/C14H24N4O2S/c1-11-4-2-5-12(8-11)9-21(19,20)17-13-6-3-7-18-14(13)15-10-16-18/h10-13,17H,2-9H2,1H3 |
| InChIKey | SXHOWOVBFYOJAQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |