C12H20N2O4S — CID 138010025
[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 138010025) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is [(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | [(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 138010025 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | [(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(N1CCS(=O)(=O)CC1)[C@]12CNC[C@H]1CCOC2 |
| InChI | InChI=1S/C12H20N2O4S/c15-11(14-2-5-19(16,17)6-3-14)12-8-13-7-10(12)1-4-18-9-12/h10,13H,1-9H2/t10-,12+/m1/s1 |
| InChIKey | HUMCKWQANWBCPI-PWSUYJOCSA-N |
| XLogP | -1.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |