C13H21N3O3 — CID 138010076
4-[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carbonyl]-1-methylpiperazin-2-one (PubChem CID 138010076) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carbonyl]-1-methylpiperazin-2-one.
| Compound Name | 4-[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carbonyl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 138010076 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carbonyl]-1-methylpiperazin-2-one |
| SMILES | CN1CCN(C(=O)[C@]23CNC[C@H]2CCOC3)CC1=O |
| InChI | InChI=1S/C13H21N3O3/c1-15-3-4-16(7-11(15)17)12(18)13-8-14-6-10(13)2-5-19-9-13/h10,14H,2-9H2,1H3/t10-,13+/m1/s1 |
| InChIKey | KEFULBKXGTVGSY-MFKMUULPSA-N |
| XLogP | -1.09 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |