C15H27N3O2 — CID 138011099
[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(4-amino-4-ethylpiperidin-1-yl)methanone (PubChem CID 138011099) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is [(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(4-amino-4-ethylpiperidin-1-yl)methanone.
| Compound Name | [(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(4-amino-4-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 138011099 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | [(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-3a-yl]-(4-amino-4-ethylpiperidin-1-yl)methanone |
| SMILES | CCC1(N)CCN(C(=O)[C@]23CNC[C@H]2CCOC3)CC1 |
| InChI | InChI=1S/C15H27N3O2/c1-2-14(16)4-6-18(7-5-14)13(19)15-10-17-9-12(15)3-8-20-11-15/h12,17H,2-11,16H2,1H3/t12-,15+/m1/s1 |
| InChIKey | WOOFRBDCAJIYSY-DOMZBBRYSA-N |
| XLogP | 0.34 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |