C16H20F2N2O2 — CID 138011244
(3aS,7aS)-N-[(2,6-difluoro-4-methylphenyl)methyl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide (PubChem CID 138011244) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is (3aS,7aS)-N-[(2,6-difluoro-4-methylphenyl)methyl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aS,7aS)-N-[(2,6-difluoro-4-methylphenyl)methyl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 138011244 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (3aS,7aS)-N-[(2,6-difluoro-4-methylphenyl)methyl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide |
| SMILES | Cc1cc(F)c(CNC(=O)[C@]23CNC[C@H]2CCOC3)c(F)c1 |
| InChI | InChI=1S/C16H20F2N2O2/c1-10-4-13(17)12(14(18)5-10)7-20-15(21)16-8-19-6-11(16)2-3-22-9-16/h4-5,11,19H,2-3,6-9H2,1H3,(H,20,21)/t11-,16+/m1/s1 |
| InChIKey | DHSSHMXTUHRXDX-BZNIZROVSA-N |
| XLogP | 1.52 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |