About N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide
N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide (PubChem CID 138011726) has the molecular formula C17H25FN2O3
and a molecular weight of 324.40 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide |
| PubChem CID | 138011726 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)N2CCCC(C)(F)C2)c(OC)c1 |
| InChI | InChI=1S/C17H25FN2O3/c1-12(14-7-6-13(22-3)10-15(14)23-4)19-16(21)20-9-5-8-17(2,18)11-20/h6-7,10,12H,5,8-9,11H2,1-4H3,(H,19,21)/t12-,17?/m1/s1 |
| InChIKey | MJLPTNNPFIQBSN-MTATWXBHSA-N |
| XLogP | 3.30 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide?
The IUPAC name of N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide (CID 138011726) is N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide.
What is the SMILES notation for N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide?
The canonical SMILES for N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide is COc1ccc([C@@H](C)NC(=O)N2CCCC(C)(F)C2)c(OC)c1.
What is the InChIKey of N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide?
The InChIKey is MJLPTNNPFIQBSN-MTATWXBHSA-N. The full InChI is InChI=1S/C17H25FN2O3/c1-12(14-7-6-13(22-3)10-15(14)23-4)19-16(21)20-9-5-8-17(2,18)11-20/h6-7,10,12H,5,8-9,11H2,1-4H3,(H,19,21)/t12-,17?/m1/s1.
What are the key properties of N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide?
N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide has a molecular weight of 324.40 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-fluoro-3-methylpiperidine-1-carboxamide is sourced from PubChem (CID 138011726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).