C18H25Cl2N3O — CID 138011974
(2S)-2-amino-N-[[3-(aminomethyl)phenyl]methyl]-4-phenylbutanamide;dihydrochloride (PubChem CID 138011974) has the molecular formula C18H25Cl2N3O and a molecular weight of 370.32 g/mol. Its IUPAC name is (2S)-2-amino-N-[[3-(aminomethyl)phenyl]methyl]-4-phenylbutanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-[[3-(aminomethyl)phenyl]methyl]-4-phenylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 138011974 |
| Molecular Formula | C18H25Cl2N3O |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2S)-2-amino-N-[[3-(aminomethyl)phenyl]methyl]-4-phenylbutanamide;dihydrochloride |
| SMILES | Cl.Cl.NCc1cccc(CNC(=O)[C@@H](N)CCc2ccccc2)c1 |
| InChI | InChI=1S/C18H23N3O.2ClH/c19-12-15-7-4-8-16(11-15)13-21-18(22)17(20)10-9-14-5-2-1-3-6-14;;/h1-8,11,17H,9-10,12-13,19-20H2,(H,21,22);2*1H/t17-;;/m0../s1 |
| InChIKey | SNPDVQIOVXAWBA-RMRYJAPISA-N |
| XLogP | 2.57 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |