C18H28F2N4O — CID 138012801
(3aR,6aS)-1'-[[1-(2,2-difluoroethyl)imidazol-2-yl]methyl]-1-ethylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine] (PubChem CID 138012801) has the molecular formula C18H28F2N4O and a molecular weight of 354.45 g/mol. Its IUPAC name is (3aR,6aS)-1'-[[1-(2,2-difluoroethyl)imidazol-2-yl]methyl]-1-ethylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine].
| Compound Name | (3aR,6aS)-1'-[[1-(2,2-difluoroethyl)imidazol-2-yl]methyl]-1-ethylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine] |
|---|---|
| PubChem CID | 138012801 |
| Molecular Formula | C18H28F2N4O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (3aR,6aS)-1'-[[1-(2,2-difluoroethyl)imidazol-2-yl]methyl]-1-ethylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine] |
| SMILES | CCN1CC2(CCN(Cc3nccn3CC(F)F)CC2)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C18H28F2N4O/c1-2-23-13-18(14-11-25-12-15(14)23)3-6-22(7-4-18)10-17-21-5-8-24(17)9-16(19)20/h5,8,14-16H,2-4,6-7,9-13H2,1H3/t14-,15+/m0/s1 |
| InChIKey | MVBXMSNVTDMDGV-LSDHHAIUSA-N |
| XLogP | 2.08 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |