C21H26N4O2 — CID 138012938
(3aS,5S,6aS)-4-[(1-benzylpyrazol-4-yl)methyl]-N-cyclopropyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide (PubChem CID 138012938) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (3aS,5S,6aS)-4-[(1-benzylpyrazol-4-yl)methyl]-N-cyclopropyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aS,5S,6aS)-4-[(1-benzylpyrazol-4-yl)methyl]-N-cyclopropyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 138012938 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (3aS,5S,6aS)-4-[(1-benzylpyrazol-4-yl)methyl]-N-cyclopropyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide |
| SMILES | O=C(NC1CC1)[C@@H]1C[C@@H]2OCC[C@@H]2N1Cc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H26N4O2/c26-21(23-17-6-7-17)19-10-20-18(8-9-27-20)25(19)14-16-11-22-24(13-16)12-15-4-2-1-3-5-15/h1-5,11,13,17-20H,6-10,12,14H2,(H,23,26)/t18-,19-,20-/m0/s1 |
| InChIKey | UMMCNGLXIWSKNA-UFYCRDLUSA-N |
| XLogP | 1.94 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |