C19H25N3O4 — CID 138013174
(3aS,5S,6aS)-N-cyclopropyl-4-[2-(cyclopropylmethyl)-4-methyl-1,3-oxazole-5-carbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide (PubChem CID 138013174) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (3aS,5S,6aS)-N-cyclopropyl-4-[2-(cyclopropylmethyl)-4-methyl-1,3-oxazole-5-carbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aS,5S,6aS)-N-cyclopropyl-4-[2-(cyclopropylmethyl)-4-methyl-1,3-oxazole-5-carbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 138013174 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (3aS,5S,6aS)-N-cyclopropyl-4-[2-(cyclopropylmethyl)-4-methyl-1,3-oxazole-5-carbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cc1nc(CC2CC2)oc1C(=O)N1[C@H](C(=O)NC2CC2)C[C@@H]2OCC[C@@H]21 |
| InChI | InChI=1S/C19H25N3O4/c1-10-17(26-16(20-10)8-11-2-3-11)19(24)22-13-6-7-25-15(13)9-14(22)18(23)21-12-4-5-12/h11-15H,2-9H2,1H3,(H,21,23)/t13-,14-,15-/m0/s1 |
| InChIKey | ZSNLEJRDECIFKH-KKUMJFAQSA-N |
| XLogP | 1.59 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |