C14H16FNO4 — CID 138013256
methyl 4-fluoro-5-methoxy-2-[(2-methylcyclopropanecarbonyl)amino]benzoate (PubChem CID 138013256) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is methyl 4-fluoro-5-methoxy-2-[(2-methylcyclopropanecarbonyl)amino]benzoate.
| Compound Name | methyl 4-fluoro-5-methoxy-2-[(2-methylcyclopropanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 138013256 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | methyl 4-fluoro-5-methoxy-2-[(2-methylcyclopropanecarbonyl)amino]benzoate |
| SMILES | COC(=O)c1cc(OC)c(F)cc1NC(=O)C1CC1C |
| InChI | InChI=1S/C14H16FNO4/c1-7-4-8(7)13(17)16-11-6-10(15)12(19-2)5-9(11)14(18)20-3/h5-8H,4H2,1-3H3,(H,16,17) |
| InChIKey | YFBTXISAIRBRRH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |