C12H19N5O2 — CID 138013425
1-ethyl-3-[(3R,4R)-3-(pyrimidin-4-ylamino)oxan-4-yl]urea (PubChem CID 138013425) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-ethyl-3-[(3R,4R)-3-(pyrimidin-4-ylamino)oxan-4-yl]urea.
| Compound Name | 1-ethyl-3-[(3R,4R)-3-(pyrimidin-4-ylamino)oxan-4-yl]urea |
|---|---|
| PubChem CID | 138013425 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-ethyl-3-[(3R,4R)-3-(pyrimidin-4-ylamino)oxan-4-yl]urea |
| SMILES | CCNC(=O)N[C@@H]1CCOC[C@@H]1Nc1ccncn1 |
| InChI | InChI=1S/C12H19N5O2/c1-2-14-12(18)17-9-4-6-19-7-10(9)16-11-3-5-13-8-15-11/h3,5,8-10H,2,4,6-7H2,1H3,(H,13,15,16)(H2,14,17,18)/t9-,10+/m1/s1 |
| InChIKey | FKYBVQJDYAIGJD-ZJUUUORDSA-N |
| XLogP | 0.37 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |