About 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol
1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol (PubChem CID 138013529) has the molecular formula C12H13F3N4OS
and a molecular weight of 318.32 g/mol. Its IUPAC name is 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol |
| PubChem CID | 138013529 |
| Molecular Formula | C12H13F3N4OS |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol |
| SMILES | CN(CC1(O)CCC1)c1ncnc2sc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C12H13F3N4OS/c1-19(5-11(20)3-2-4-11)8-7-9(17-6-16-8)21-10(18-7)12(13,14)15/h6,20H,2-5H2,1H3 |
| InChIKey | XFFHRQBEIXCGPQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol?
The IUPAC name of 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol (CID 138013529) is 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol.
What is the SMILES notation for 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol?
The canonical SMILES for 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol is CN(CC1(O)CCC1)c1ncnc2sc(C(F)(F)F)nc12.
What is the InChIKey of 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol?
The InChIKey is XFFHRQBEIXCGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N4OS/c1-19(5-11(20)3-2-4-11)8-7-9(17-6-16-8)21-10(18-7)12(13,14)15/h6,20H,2-5H2,1H3.
What are the key properties of 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol?
1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol has a molecular weight of 318.32 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[methyl-[2-(trifluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidin-7-yl]amino]methyl]cyclobutan-1-ol is sourced from PubChem (CID 138013529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).