About N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide
N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide (PubChem CID 138013859) has the molecular formula C9H11ClN2O2S2
and a molecular weight of 278.79 g/mol. Its IUPAC name is N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide |
| PubChem CID | 138013859 |
| Molecular Formula | C9H11ClN2O2S2 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide |
| SMILES | Cc1onc(NC(=O)C2CSCCS2)c1Cl |
| InChI | InChI=1S/C9H11ClN2O2S2/c1-5-7(10)8(12-14-5)11-9(13)6-4-15-2-3-16-6/h6H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | HAOOIUHDIQQGRP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide?
The IUPAC name of N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide (CID 138013859) is N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide.
What is the SMILES notation for N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide?
The canonical SMILES for N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide is Cc1onc(NC(=O)C2CSCCS2)c1Cl.
What is the InChIKey of N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide?
The InChIKey is HAOOIUHDIQQGRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O2S2/c1-5-7(10)8(12-14-5)11-9(13)6-4-15-2-3-16-6/h6H,2-4H2,1H3,(H,11,12,13).
What are the key properties of N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide?
N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide has a molecular weight of 278.79 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chloro-5-methyl-1,2-oxazol-3-yl)-1,4-dithiane-2-carboxamide is sourced from PubChem (CID 138013859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).