About methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate
methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate (PubChem CID 138014307) has the molecular formula C12H13N3O4S
and a molecular weight of 295.32 g/mol. Its IUPAC name is methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate |
| PubChem CID | 138014307 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1csc(NC(=O)NCc2nocc2C)c1 |
| InChI | InChI=1S/C12H13N3O4S/c1-7-5-19-15-9(7)4-13-12(17)14-10-3-8(6-20-10)11(16)18-2/h3,5-6H,4H2,1-2H3,(H2,13,14,17) |
| InChIKey | RJHJOEPNBMSZHK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate?
The IUPAC name of methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate (CID 138014307) is methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate.
What is the SMILES notation for methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate?
The canonical SMILES for methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate is COC(=O)c1csc(NC(=O)NCc2nocc2C)c1.
What is the InChIKey of methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate?
The InChIKey is RJHJOEPNBMSZHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O4S/c1-7-5-19-15-9(7)4-13-12(17)14-10-3-8(6-20-10)11(16)18-2/h3,5-6H,4H2,1-2H3,(H2,13,14,17).
What are the key properties of methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate?
methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate has a molecular weight of 295.32 g/mol, XLogP of 2.15, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(4-methyl-1,2-oxazol-3-yl)methylcarbamoylamino]thiophene-3-carboxylate is sourced from PubChem (CID 138014307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).