C14H23N3O3 — CID 138014825
1-[4-[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carbonyl]piperazin-1-yl]ethanone (PubChem CID 138014825) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-[4-[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 138014825 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-[4-[(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)[C@]23CNC[C@H]2CCOC3)CC1 |
| InChI | InChI=1S/C14H23N3O3/c1-11(18)16-3-5-17(6-4-16)13(19)14-9-15-8-12(14)2-7-20-10-14/h12,15H,2-10H2,1H3/t12-,14+/m1/s1 |
| InChIKey | GPOKCOOQQJGCAD-OCCSQVGLSA-N |
| XLogP | -0.70 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |