C14H25N3O2 — CID 138014836
(3aS,7aS)-N-(piperidin-4-ylmethyl)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide (PubChem CID 138014836) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is (3aS,7aS)-N-(piperidin-4-ylmethyl)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aS,7aS)-N-(piperidin-4-ylmethyl)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 138014836 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | (3aS,7aS)-N-(piperidin-4-ylmethyl)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxamide |
| SMILES | O=C(NCC1CCNCC1)[C@]12CNC[C@H]1CCOC2 |
| InChI | InChI=1S/C14H25N3O2/c18-13(17-7-11-1-4-15-5-2-11)14-9-16-8-12(14)3-6-19-10-14/h11-12,15-16H,1-10H2,(H,17,18)/t12-,14+/m1/s1 |
| InChIKey | JNEJINYFMGERSY-OCCSQVGLSA-N |
| XLogP | -0.27 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |