C13H19NO4 — CID 138015024
N-(2-hydroxypropoxy)-2-(3-methoxyphenyl)propanamide (PubChem CID 138015024) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(2-hydroxypropoxy)-2-(3-methoxyphenyl)propanamide.
| Compound Name | N-(2-hydroxypropoxy)-2-(3-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 138015024 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(2-hydroxypropoxy)-2-(3-methoxyphenyl)propanamide |
| SMILES | COc1cccc(C(C)C(=O)NOCC(C)O)c1 |
| InChI | InChI=1S/C13H19NO4/c1-9(15)8-18-14-13(16)10(2)11-5-4-6-12(7-11)17-3/h4-7,9-10,15H,8H2,1-3H3,(H,14,16) |
| InChIKey | DVPMBTBNSXPFSL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|