C13H16F2O4S — CID 138015274
(4-acetylphenyl) 3,3-difluoro-2,2-dimethylpropane-1-sulfonate (PubChem CID 138015274) has the molecular formula C13H16F2O4S and a molecular weight of 306.33 g/mol. Its IUPAC name is (4-acetylphenyl) 3,3-difluoro-2,2-dimethylpropane-1-sulfonate.
| Compound Name | (4-acetylphenyl) 3,3-difluoro-2,2-dimethylpropane-1-sulfonate |
|---|---|
| PubChem CID | 138015274 |
| Molecular Formula | C13H16F2O4S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (4-acetylphenyl) 3,3-difluoro-2,2-dimethylpropane-1-sulfonate |
| SMILES | CC(=O)c1ccc(OS(=O)(=O)CC(C)(C)C(F)F)cc1 |
| InChI | InChI=1S/C13H16F2O4S/c1-9(16)10-4-6-11(7-5-10)19-20(17,18)8-13(2,3)12(14)15/h4-7,12H,8H2,1-3H3 |
| InChIKey | QUYJXYGVWFEQGE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|