C19H26N2O4S — CID 138015686
1-[(3aR,6aS)-1'-(2-methylsulfonylphenyl)spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]ethanone (PubChem CID 138015686) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 1-[(3aR,6aS)-1'-(2-methylsulfonylphenyl)spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]ethanone.
| Compound Name | 1-[(3aR,6aS)-1'-(2-methylsulfonylphenyl)spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]ethanone |
|---|---|
| PubChem CID | 138015686 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[(3aR,6aS)-1'-(2-methylsulfonylphenyl)spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]ethanone |
| SMILES | CC(=O)N1CC2(CCN(c3ccccc3S(C)(=O)=O)CC2)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C19H26N2O4S/c1-14(22)21-13-19(15-11-25-12-17(15)21)7-9-20(10-8-19)16-5-3-4-6-18(16)26(2,23)24/h3-6,15,17H,7-13H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | XVZRKGPXFUCGCD-DOTOQJQBSA-N |
| XLogP | 1.55 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |