C19H30N4O2 — CID 138015776
[(3aR,6aS)-1'-methylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]-(3-methyl-1-propan-2-ylpyrazol-4-yl)methanone (PubChem CID 138015776) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is [(3aR,6aS)-1'-methylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]-(3-methyl-1-propan-2-ylpyrazol-4-yl)methanone.
| Compound Name | [(3aR,6aS)-1'-methylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]-(3-methyl-1-propan-2-ylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 138015776 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | [(3aR,6aS)-1'-methylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]-(3-methyl-1-propan-2-ylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C(C)C)cc1C(=O)N1CC2(CCN(C)CC2)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C19H30N4O2/c1-13(2)23-9-15(14(3)20-23)18(24)22-12-19(5-7-21(4)8-6-19)16-10-25-11-17(16)22/h9,13,16-17H,5-8,10-12H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | GTPIOSLGJBMGIH-DLBZAZTESA-N |
| XLogP | 1.96 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |