C20H29N5O3 — CID 138015779
[(3aR,6aS)-1'-methylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]-(6-morpholin-4-ylpyrimidin-4-yl)methanone (PubChem CID 138015779) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is [(3aR,6aS)-1'-methylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]-(6-morpholin-4-ylpyrimidin-4-yl)methanone.
| Compound Name | [(3aR,6aS)-1'-methylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]-(6-morpholin-4-ylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 138015779 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | [(3aR,6aS)-1'-methylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]-(6-morpholin-4-ylpyrimidin-4-yl)methanone |
| SMILES | CN1CCC2(CC1)CN(C(=O)c1cc(N3CCOCC3)ncn1)[C@@H]1COC[C@@H]12 |
| InChI | InChI=1S/C20H29N5O3/c1-23-4-2-20(3-5-23)13-25(17-12-28-11-15(17)20)19(26)16-10-18(22-14-21-16)24-6-8-27-9-7-24/h10,14-15,17H,2-9,11-13H2,1H3/t15-,17+/m0/s1 |
| InChIKey | WRRLDLIQWSQZEQ-DOTOQJQBSA-N |
| XLogP | 0.50 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |