C17H28N2O3 — CID 138016083
[(3aS,5S,6aS)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-5-yl]-(1-oxa-4-azaspiro[5.6]dodecan-4-yl)methanone (PubChem CID 138016083) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is [(3aS,5S,6aS)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-5-yl]-(1-oxa-4-azaspiro[5.6]dodecan-4-yl)methanone.
| Compound Name | [(3aS,5S,6aS)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-5-yl]-(1-oxa-4-azaspiro[5.6]dodecan-4-yl)methanone |
|---|---|
| PubChem CID | 138016083 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | [(3aS,5S,6aS)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-5-yl]-(1-oxa-4-azaspiro[5.6]dodecan-4-yl)methanone |
| SMILES | O=C([C@@H]1C[C@@H]2OCC[C@@H]2N1)N1CCOC2(CCCCCC2)C1 |
| InChI | InChI=1S/C17H28N2O3/c20-16(14-11-15-13(18-14)5-9-21-15)19-8-10-22-17(12-19)6-3-1-2-4-7-17/h13-15,18H,1-12H2/t13-,14-,15-/m0/s1 |
| InChIKey | SWIRPFIPYLIDIU-KKUMJFAQSA-N |
| XLogP | 1.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |