C19H23N3O4S — CID 138016258
(3aS,6aS)-N,N-dimethyl-4-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide (PubChem CID 138016258) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is (3aS,6aS)-N,N-dimethyl-4-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aS)-N,N-dimethyl-4-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 138016258 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (3aS,6aS)-N,N-dimethyl-4-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cc1oc(-c2cccs2)nc1CC(=O)N1C(C(=O)N(C)C)C[C@@H]2OCC[C@@H]21 |
| InChI | InChI=1S/C19H23N3O4S/c1-11-12(20-18(26-11)16-5-4-8-27-16)9-17(23)22-13-6-7-25-15(13)10-14(22)19(24)21(2)3/h4-5,8,13-15H,6-7,9-10H2,1-3H3/t13-,14?,15-/m0/s1 |
| InChIKey | ZEYWOTUMTJUDSP-LWEDLAQUSA-N |
| XLogP | 2.10 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |