C14H19N5O2S — CID 138016927
N-ethyl-3-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 138016927) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is N-ethyl-3-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | N-ethyl-3-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 138016927 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-ethyl-3-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | CCN(CCc1nccs1)C(=O)C1CCc2n[nH]c(=O)n2C1 |
| InChI | InChI=1S/C14H19N5O2S/c1-2-18(7-5-12-15-6-8-22-12)13(20)10-3-4-11-16-17-14(21)19(11)9-10/h6,8,10H,2-5,7,9H2,1H3,(H,17,21) |
| InChIKey | BEXHCUAFCCBTIU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |